C15H16BrFN6O — CID 139376918
6-[[5-bromo-6-(3-fluoropropoxy)-2-pyridinyl]methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 139376918) has the molecular formula C15H16BrFN6O and a molecular weight of 395.24 g/mol. Its IUPAC name is 6-[[5-bromo-6-(3-fluoropropoxy)-2-pyridinyl]methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-[[5-bromo-6-(3-fluoropropoxy)-2-pyridinyl]methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 139376918 |
| Molecular Formula | C15H16BrFN6O |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 6-[[5-bromo-6-(3-fluoropropoxy)-2-pyridinyl]methyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2ncnn2c(N)c1Cc1ccc(Br)c(OCCCF)n1 |
| InChI | InChI=1S/C15H16BrFN6O/c1-9-11(13(18)23-15(21-9)19-8-20-23)7-10-3-4-12(16)14(22-10)24-6-2-5-17/h3-4,8H,2,5-7,18H2,1H3 |
| InChIKey | BOVMDNGITSNKSC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|