C23H24N4O4 — CID 139377111
[4-(1-hydroxycyclobutanecarbonyl)piperazin-1-yl]-[4-(2-hydroxyindazol-6-yl)phenyl]methanone (PubChem CID 139377111) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is [4-(1-hydroxycyclobutanecarbonyl)piperazin-1-yl]-[4-(2-hydroxyindazol-6-yl)phenyl]methanone.
| Compound Name | [4-(1-hydroxycyclobutanecarbonyl)piperazin-1-yl]-[4-(2-hydroxyindazol-6-yl)phenyl]methanone |
|---|---|
| PubChem CID | 139377111 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [4-(1-hydroxycyclobutanecarbonyl)piperazin-1-yl]-[4-(2-hydroxyindazol-6-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc3cn(O)nc3c2)cc1)N1CCN(C(=O)C2(O)CCC2)CC1 |
| InChI | InChI=1S/C23H24N4O4/c28-21(25-10-12-26(13-11-25)22(29)23(30)8-1-9-23)17-4-2-16(3-5-17)18-6-7-19-15-27(31)24-20(19)14-18/h2-7,14-15,30-31H,1,8-13H2 |
| InChIKey | OKYAWFVQPRRNEG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|