C34H45N3O5 — CID 139377362
(2-hydroperoxy-4-spiro[3,4-dihydro-1H-quinoline-2,1'-cycloundecane]-6-ylphenyl)-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone (PubChem CID 139377362) has the molecular formula C34H45N3O5 and a molecular weight of 575.75 g/mol. Its IUPAC name is (2-hydroperoxy-4-spiro[3,4-dihydro-1H-quinoline-2,1'-cycloundecane]-6-ylphenyl)-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | (2-hydroperoxy-4-spiro[3,4-dihydro-1H-quinoline-2,1'-cycloundecane]-6-ylphenyl)-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 139377362 |
| Molecular Formula | C34H45N3O5 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | (2-hydroperoxy-4-spiro[3,4-dihydro-1H-quinoline-2,1'-cycloundecane]-6-ylphenyl)-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccc3c(c2)CCC2(CCCCCCCCCC2)N3)cc1OO)N1CCN(C(=O)C2(O)CC2)CC1 |
| InChI | InChI=1S/C34H45N3O5/c38-31(36-19-21-37(22-20-36)32(39)34(40)17-18-34)28-11-9-26(24-30(28)42-41)25-10-12-29-27(23-25)13-16-33(35-29)14-7-5-3-1-2-4-6-8-15-33/h9-12,23-24,35,40-41H,1-8,13-22H2 |
| InChIKey | WIOIEQSOCLZZRD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|