C15H23NO5 — CID 139377391
methyl 3-[(2S,5S)-5-(2-cyanoethyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate (PubChem CID 139377391) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl 3-[(2S,5S)-5-(2-cyanoethyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,5S)-5-(2-cyanoethyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate |
|---|---|
| PubChem CID | 139377391 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | methyl 3-[(2S,5S)-5-(2-cyanoethyl)-3a-(hydroxymethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CC2(CO)O[C@@H](CCC#N)CCC2O1 |
| InChI | InChI=1S/C15H23NO5/c1-19-14(18)7-5-12-9-15(10-17)13(20-12)6-4-11(21-15)3-2-8-16/h11-13,17H,2-7,9-10H2,1H3/t11-,12-,13?,15?/m0/s1 |
| InChIKey | JSLHRBBTSDYVBG-YKQCJFHZSA-N |
| XLogP | 1.31 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |