C27H33F3N8O3 — CID 139377693
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 139377693) has the molecular formula C27H33F3N8O3 and a molecular weight of 574.61 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139377693 |
| Molecular Formula | C27H33F3N8O3 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)anilino]-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncnc(Nc3ccccc3C(C)(O)C(F)(F)F)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C27H33F3N8O3/c1-7-23(39)33-19-14-20(22(41-6)15-21(19)38(5)13-12-37(3)4)35-25-32-16-31-24(36-25)34-18-11-9-8-10-17(18)26(2,40)27(28,29)30/h7-11,14-16,40H,1,12-13H2,2-6H3,(H,33,39)(H2,31,32,34,35,36) |
| InChIKey | PTPHYGJNVDJTAD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|