C29H35ClFN7O3 — CID 139377809
Sunvozertinib (PubChem CID 139377809) has the molecular formula C29H35ClFN7O3 and a molecular weight of 584.10 g/mol. Its IUPAC name is N-[5-[[4-[5-chloro-4-fluoro-2-(2-hydroxypropan-2-yl)anilino]pyrimidin-2-yl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | Sunvozertinib |
|---|---|
| PubChem CID | 139377809 |
| Molecular Formula | C29H35ClFN7O3 |
| Molecular Weight | 584.10 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | N-[5-[[4-[5-chloro-4-fluoro-2-(2-hydroxypropan-2-yl)anilino]pyrimidin-2-yl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methoxyphenyl]prop-2-enamide |
| SMILES | CC(C)(C1=CC(=C(C=C1NC2=NC(=NC=C2)NC3=C(C=C(C(=C3)NC(=O)C=C)N4CC[C@H](C4)N(C)C)OC)Cl)F)O |
| InChI | InChI=1S/C29H35ClFN7O3/c1-7-27(39)34-22-14-23(25(41-6)15-24(22)38-11-9-17(16-38)37(4)5)35-28-32-10-8-26(36-28)33-21-13-19(30)20(31)12-18(21)29(2,3)40/h7-8,10,12-15,17,40H,1,9,11,16H2,2-6H3,(H,34,39)(H2,32,33,35,36)/t17-/m1/s1 |
| InChIKey | BTMKEDDEMKKSEF-QGZVFWFLSA-N |
| XLogP | 5.00 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | 885 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.10 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|