C25H29N5O4 — CID 139377821
ethyl N-[7-(2-aminoanilino)-1,7-dioxo-1-(quinolin-8-ylamino)heptan-2-yl]carbamate (PubChem CID 139377821) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is ethyl N-[7-(2-aminoanilino)-1,7-dioxo-1-(quinolin-8-ylamino)heptan-2-yl]carbamate.
| Compound Name | ethyl N-[7-(2-aminoanilino)-1,7-dioxo-1-(quinolin-8-ylamino)heptan-2-yl]carbamate |
|---|---|
| PubChem CID | 139377821 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | ethyl N-[7-(2-aminoanilino)-1,7-dioxo-1-(quinolin-8-ylamino)heptan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CCCCC(=O)Nc1ccccc1N)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C25H29N5O4/c1-2-34-25(33)30-21(13-5-6-15-22(31)28-19-12-4-3-11-18(19)26)24(32)29-20-14-7-9-17-10-8-16-27-23(17)20/h3-4,7-12,14,16,21H,2,5-6,13,15,26H2,1H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | JFPINYPTSSFWSM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|