C18H22O10 — CID 139377922
[(2E,6E)-3,6-dimethyl-8-(2-oxo-1,3-dioxolane-4-carbonyl)oxyocta-2,6-dienyl] 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 139377922) has the molecular formula C18H22O10 and a molecular weight of 398.36 g/mol. Its IUPAC name is [(2E,6E)-3,6-dimethyl-8-(2-oxo-1,3-dioxolane-4-carbonyl)oxyocta-2,6-dienyl] 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | [(2E,6E)-3,6-dimethyl-8-(2-oxo-1,3-dioxolane-4-carbonyl)oxyocta-2,6-dienyl] 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 139377922 |
| Molecular Formula | C18H22O10 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [(2E,6E)-3,6-dimethyl-8-(2-oxo-1,3-dioxolane-4-carbonyl)oxyocta-2,6-dienyl] 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | C/C(=C\COC(=O)C1COC(=O)O1)CC/C(C)=C/COC(=O)C1COC(=O)O1 |
| InChI | InChI=1S/C18H22O10/c1-11(5-7-23-15(19)13-9-25-17(21)27-13)3-4-12(2)6-8-24-16(20)14-10-26-18(22)28-14/h5-6,13-14H,3-4,7-10H2,1-2H3/b11-5+,12-6+ |
| InChIKey | SZZFLHVRLHTURV-YDWXAUTNSA-N |
| XLogP | 1.82 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|