About (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol
(1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol (PubChem CID 139378075) has the molecular formula C5H8ClNO
and a molecular weight of 133.58 g/mol. Its IUPAC name is (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol.
Molecular Properties
| Compound Name | (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol |
| PubChem CID | 139378075 |
| Molecular Formula | C5H8ClNO |
| Molecular Weight | 133.58 g/mol |
| Exact Mass | 133.03 |
| IUPAC Name | (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol |
| SMILES | C/C(N)=C\C=C(/O)Cl |
| InChI | InChI=1S/C5H8ClNO/c1-4(7)2-3-5(6)8/h2-3,8H,7H2,1H3/b4-2+,5-3- |
| InChIKey | CWMYJCCFWZBFFM-HZDAAVBUSA-N |
| XLogP | 1.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.58 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol?
The IUPAC name of (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol (CID 139378075) is (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol.
What is the SMILES notation for (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol?
The canonical SMILES for (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol is C/C(N)=C\C=C(/O)Cl.
What is the InChIKey of (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol?
The InChIKey is CWMYJCCFWZBFFM-HZDAAVBUSA-N. The full InChI is InChI=1S/C5H8ClNO/c1-4(7)2-3-5(6)8/h2-3,8H,7H2,1H3/b4-2+,5-3-.
What are the key properties of (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol?
(1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol has a molecular weight of 133.58 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-4-amino-1-chloropenta-1,3-dien-1-ol is sourced from PubChem (CID 139378075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).