About (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine
(E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine (PubChem CID 139378380) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine.
Molecular Properties
| Compound Name | (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine |
| PubChem CID | 139378380 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine |
| SMILES | CCN/C(C)=C/C(=N\C)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-7-13-9(2)8-10(12-6)11(3,4)5/h8,13H,7H2,1-6H3/b9-8+,12-10+ |
| InChIKey | QJWYJLAYFCKMHN-CDKJVOIVSA-N |
| XLogP | 2.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine?
The IUPAC name of (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine (CID 139378380) is (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine.
What is the SMILES notation for (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine?
The canonical SMILES for (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine is CCN/C(C)=C/C(=N\C)C(C)(C)C.
What is the InChIKey of (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine?
The InChIKey is QJWYJLAYFCKMHN-CDKJVOIVSA-N. The full InChI is InChI=1S/C11H22N2/c1-7-13-9(2)8-10(12-6)11(3,4)5/h8,13H,7H2,1-6H3/b9-8+,12-10+.
What are the key properties of (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine?
(E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine has a molecular weight of 182.31 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-ethyl-5,5-dimethyl-4-methyliminohex-2-en-2-amine is sourced from PubChem (CID 139378380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).