C21H23FN6S — CID 139378502
4-[5-fluoro-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-yl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-1,3-thiazol-2-amine (PubChem CID 139378502) has the molecular formula C21H23FN6S and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[5-fluoro-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-yl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[5-fluoro-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-yl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 139378502 |
| Molecular Formula | C21H23FN6S |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[5-fluoro-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-yl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1cn(C2=C(F)CC(c3csc(Nc4c5c(nn4C)CCCC5)n3)C=C2)cn1 |
| InChI | InChI=1S/C21H23FN6S/c1-13-10-28(12-23-13)19-8-7-14(9-16(19)22)18-11-29-21(24-18)25-20-15-5-3-4-6-17(15)26-27(20)2/h7-8,10-12,14H,3-6,9H2,1-2H3,(H,24,25) |
| InChIKey | GQFDAFRVECGTNY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |