C13H13BrO3 — CID 139378543
(2E)-2-(2-bromo-5-hydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)acetic acid (PubChem CID 139378543) has the molecular formula C13H13BrO3 and a molecular weight of 297.15 g/mol. Its IUPAC name is (2E)-2-(2-bromo-5-hydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)acetic acid.
| Compound Name | (2E)-2-(2-bromo-5-hydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)acetic acid |
|---|---|
| PubChem CID | 139378543 |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | (2E)-2-(2-bromo-5-hydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-ylidene)acetic acid |
| SMILES | O=C(O)/C=C1\CCCc2cc(Br)ccc2C1O |
| InChI | InChI=1S/C13H13BrO3/c14-10-4-5-11-8(6-10)2-1-3-9(13(11)17)7-12(15)16/h4-7,13,17H,1-3H2,(H,15,16)/b9-7+ |
| InChIKey | GCPGLVNWROVRRR-VQHVLOKHSA-N |
| XLogP | 2.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|