C10H18N2 — CID 139378567
2-ethyl-3-methyl-3,3a,4,5,6,7-hexahydroindazole (PubChem CID 139378567) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-ethyl-3-methyl-3,3a,4,5,6,7-hexahydroindazole.
| Compound Name | 2-ethyl-3-methyl-3,3a,4,5,6,7-hexahydroindazole |
|---|---|
| PubChem CID | 139378567 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-ethyl-3-methyl-3,3a,4,5,6,7-hexahydroindazole |
| SMILES | CCN1N=C2CCCCC2C1C |
| InChI | InChI=1S/C10H18N2/c1-3-12-8(2)9-6-4-5-7-10(9)11-12/h8-9H,3-7H2,1-2H3 |
| InChIKey | QQSVLZCWEISMKQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |