About (4E,5E)-4,5-di(ethylidene)-1,3-oxazole
(4E,5E)-4,5-di(ethylidene)-1,3-oxazole (PubChem CID 139378645) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1,3-oxazole.
Molecular Properties
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1,3-oxazole |
| PubChem CID | 139378645 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1,3-oxazole |
| SMILES | C/C=c1/nco/c1=C/C |
| InChI | InChI=1S/C7H9NO/c1-3-6-7(4-2)9-5-8-6/h3-5H,1-2H3/b6-3+,7-4+ |
| InChIKey | UBRDNOJRVVVTDV-XOKGJFMYSA-N |
| XLogP | 0.28 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-4,5-di(ethylidene)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4,5-di(ethylidene)-1,3-oxazole?
The IUPAC name of (4E,5E)-4,5-di(ethylidene)-1,3-oxazole (CID 139378645) is (4E,5E)-4,5-di(ethylidene)-1,3-oxazole.
What is the SMILES notation for (4E,5E)-4,5-di(ethylidene)-1,3-oxazole?
The canonical SMILES for (4E,5E)-4,5-di(ethylidene)-1,3-oxazole is C/C=c1/nco/c1=C/C.
What is the InChIKey of (4E,5E)-4,5-di(ethylidene)-1,3-oxazole?
The InChIKey is UBRDNOJRVVVTDV-XOKGJFMYSA-N. The full InChI is InChI=1S/C7H9NO/c1-3-6-7(4-2)9-5-8-6/h3-5H,1-2H3/b6-3+,7-4+.
What are the key properties of (4E,5E)-4,5-di(ethylidene)-1,3-oxazole?
(4E,5E)-4,5-di(ethylidene)-1,3-oxazole has a molecular weight of 123.15 g/mol, XLogP of 0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4,5-di(ethylidene)-1,3-oxazole is sourced from PubChem (CID 139378645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).