C31H28N2O5S — CID 139378687
N-[4-[(6-methyl-10,11-dioxo-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indol-3-yl)sulfonyl]phenyl]acetamide (PubChem CID 139378687) has the molecular formula C31H28N2O5S and a molecular weight of 540.64 g/mol. Its IUPAC name is N-[4-[(6-methyl-10,11-dioxo-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indol-3-yl)sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[(6-methyl-10,11-dioxo-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indol-3-yl)sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139378687 |
| Molecular Formula | C31H28N2O5S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N-[4-[(6-methyl-10,11-dioxo-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indol-3-yl)sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2C=C(c3ccccc3)C3C(=O)C(=O)c4c(ccc5c4CCCC5C)C32)cc1 |
| InChI | InChI=1S/C31H28N2O5S/c1-18-7-6-10-24-23(18)15-16-25-27(24)30(35)31(36)28-26(20-8-4-3-5-9-20)17-33(29(25)28)39(37,38)22-13-11-21(12-14-22)32-19(2)34/h3-5,8-9,11-18,28-29H,6-7,10H2,1-2H3,(H,32,34) |
| InChIKey | LSDDPEWNHPYELM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|