C29H26N2O4S — CID 139378688
3-(4-aminophenyl)sulfonyl-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione (PubChem CID 139378688) has the molecular formula C29H26N2O4S and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-(4-aminophenyl)sulfonyl-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione.
| Compound Name | 3-(4-aminophenyl)sulfonyl-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione |
|---|---|
| PubChem CID | 139378688 |
| Molecular Formula | C29H26N2O4S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3-(4-aminophenyl)sulfonyl-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione |
| SMILES | CC1CCCc2c1ccc1c2C(=O)C(=O)C2C(c3ccccc3)=CN(S(=O)(=O)c3ccc(N)cc3)C12 |
| InChI | InChI=1S/C29H26N2O4S/c1-17-6-5-9-22-21(17)14-15-23-25(22)28(32)29(33)26-24(18-7-3-2-4-8-18)16-31(27(23)26)36(34,35)20-12-10-19(30)11-13-20/h2-4,7-8,10-17,26-27H,5-6,9,30H2,1H3 |
| InChIKey | GANPNLKAEIQVOI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|