About 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole
3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole (PubChem CID 139378787) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole |
| PubChem CID | 139378787 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1c(-c2ncon2)cnn1C |
| InChI | InChI=1S/C7H8N4O/c1-5-6(3-9-11(5)2)7-8-4-12-10-7/h3-4H,1-2H3 |
| InChIKey | XGPIEYZQYSGMKD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole (CID 139378787) is 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole is Cc1c(-c2ncon2)cnn1C.
What is the InChIKey of 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole?
The InChIKey is XGPIEYZQYSGMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-5-6(3-9-11(5)2)7-8-4-12-10-7/h3-4H,1-2H3.
What are the key properties of 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole?
3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole has a molecular weight of 164.17 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,5-dimethylpyrazol-4-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 139378787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).