C14H12F10 — CID 139378807
1-tert-butyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene (PubChem CID 139378807) has the molecular formula C14H12F10 and a molecular weight of 370.23 g/mol. Its IUPAC name is 1-tert-butyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene.
| Compound Name | 1-tert-butyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139378807 |
| Molecular Formula | C14H12F10 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-tert-butyl-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)cc(C(F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F10/c1-10(2,3)7-4-8(6-9(5-7)12(16,17)18)11(15,13(19,20)21)14(22,23)24/h4-6H,1-3H3 |
| InChIKey | MXGBKMOTGIIWLJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |