C24H20O6S3 — CID 139378814
6-[7-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-oxo-2,3-dihydro-1,4λ4-benzoxathiin-3-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide (PubChem CID 139378814) has the molecular formula C24H20O6S3 and a molecular weight of 500.62 g/mol. Its IUPAC name is 6-[7-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-oxo-2,3-dihydro-1,4λ4-benzoxathiin-3-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide.
| Compound Name | 6-[7-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-oxo-2,3-dihydro-1,4λ4-benzoxathiin-3-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide |
|---|---|
| PubChem CID | 139378814 |
| Molecular Formula | C24H20O6S3 |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 6-[7-(2,3-dihydro-1,4-benzoxathiin-2-yl)-4-oxo-2,3-dihydro-1,4λ4-benzoxathiin-3-yl]-2,3-dihydro-1,4λ6-benzoxathiine 4,4-dioxide |
| SMILES | O=S1c2ccc(C3CSc4ccccc4O3)cc2OCC1c1ccc2c(c1)S(=O)(=O)CCO2 |
| InChI | InChI=1S/C24H20O6S3/c25-32-22-8-6-15(20-14-31-21-4-2-1-3-17(21)30-20)11-19(22)29-13-23(32)16-5-7-18-24(12-16)33(26,27)10-9-28-18/h1-8,11-12,20,23H,9-10,13-14H2 |
| InChIKey | IVEUPQDFFGDTEH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |