About cyclohepta[b]quinoline
cyclohepta[b]quinoline (PubChem CID 139378880) has the molecular formula C14H9N
and a molecular weight of 191.23 g/mol. Its IUPAC name is cyclohepta[b]quinoline.
Molecular Properties
| Compound Name | cyclohepta[b]quinoline |
| PubChem CID | 139378880 |
| Molecular Formula | C14H9N |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | cyclohepta[b]quinoline |
| SMILES | C1=CC=c2cc3ccccc3nc2=CC=1 |
| InChI | InChI=1S/C14H9N/c1-2-6-11-10-12-7-4-5-9-14(12)15-13(11)8-3-1/h2-10H |
| InChIKey | MHMRTMPPCMKHIJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohepta[b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[b]quinoline?
The IUPAC name of cyclohepta[b]quinoline (CID 139378880) is cyclohepta[b]quinoline.
What is the SMILES notation for cyclohepta[b]quinoline?
The canonical SMILES for cyclohepta[b]quinoline is C1=CC=c2cc3ccccc3nc2=CC=1.
What is the InChIKey of cyclohepta[b]quinoline?
The InChIKey is MHMRTMPPCMKHIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N/c1-2-6-11-10-12-7-4-5-9-14(12)15-13(11)8-3-1/h2-10H.
What are the key properties of cyclohepta[b]quinoline?
cyclohepta[b]quinoline has a molecular weight of 191.23 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[b]quinoline is sourced from PubChem (CID 139378880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).