About 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol
2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol (PubChem CID 139379206) has the molecular formula C20H27ClF3NO
and a molecular weight of 389.89 g/mol. Its IUPAC name is 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol |
| PubChem CID | 139379206 |
| Molecular Formula | C20H27ClF3NO |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol |
| SMILES | OCCC1CCC2(CC1)CCN(c1cc(CC(F)(F)F)ccc1Cl)CC2 |
| InChI | InChI=1S/C20H27ClF3NO/c21-17-2-1-16(14-20(22,23)24)13-18(17)25-10-8-19(9-11-25)6-3-15(4-7-19)5-12-26/h1-2,13,15,26H,3-12,14H2 |
| InChIKey | BMNFWILCDORMII-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol?
The IUPAC name of 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol (CID 139379206) is 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol.
What is the SMILES notation for 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol?
The canonical SMILES for 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol is OCCC1CCC2(CC1)CCN(c1cc(CC(F)(F)F)ccc1Cl)CC2.
What is the InChIKey of 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol?
The InChIKey is BMNFWILCDORMII-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27ClF3NO/c21-17-2-1-16(14-20(22,23)24)13-18(17)25-10-8-19(9-11-25)6-3-15(4-7-19)5-12-26/h1-2,13,15,26H,3-12,14H2.
What are the key properties of 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol?
2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol has a molecular weight of 389.89 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-chloro-5-(2,2,2-trifluoroethyl)phenyl]-3-azaspiro[5.5]undecan-9-yl]ethanol is sourced from PubChem (CID 139379206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).