C37H44N8O3 — CID 139379300
N-[4-[(E)-N-[6-(2-aminopropanoylamino)hexyl-methylamino]-C-(3-oxo-2-quinolin-7-ylpropyl)carbonimidoyl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide (PubChem CID 139379300) has the molecular formula C37H44N8O3 and a molecular weight of 648.81 g/mol. Its IUPAC name is N-[4-[(E)-N-[6-(2-aminopropanoylamino)hexyl-methylamino]-C-(3-oxo-2-quinolin-7-ylpropyl)carbonimidoyl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[(E)-N-[6-(2-aminopropanoylamino)hexyl-methylamino]-C-(3-oxo-2-quinolin-7-ylpropyl)carbonimidoyl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139379300 |
| Molecular Formula | C37H44N8O3 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | N-[4-[(E)-N-[6-(2-aminopropanoylamino)hexyl-methylamino]-C-(3-oxo-2-quinolin-7-ylpropyl)carbonimidoyl]phenyl]-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide |
| SMILES | CC(N)C(=O)NCCCCCCN(C)/N=C(\CC(C=O)c1ccc2cccnc2c1)c1ccc(NC(=O)N2Cc3ccncc3C2)cc1 |
| InChI | InChI=1S/C37H44N8O3/c1-26(38)36(47)41-16-5-3-4-6-19-44(2)43-35(21-31(25-46)29-10-9-27-8-7-17-40-34(27)20-29)28-11-13-33(14-12-28)42-37(48)45-23-30-15-18-39-22-32(30)24-45/h7-15,17-18,20,22,25-26,31H,3-6,16,19,21,23-24,38H2,1-2H3,(H,41,47)(H,42,48)/b43-35+ |
| InChIKey | GVBJOEGRIXVJEG-AMOOHMQNSA-N |
| XLogP | 5.21 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|