C13H23N3O3S — CID 139379414
(2S,3R)-2-[5-acetyl-3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]-3-hydroxybutanamide (PubChem CID 139379414) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is (2S,3R)-2-[5-acetyl-3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]-3-hydroxybutanamide.
| Compound Name | (2S,3R)-2-[5-acetyl-3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 139379414 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2S,3R)-2-[5-acetyl-3-(sulfanylmethyl)-2,5-diazaspiro[3.4]octan-2-yl]-3-hydroxybutanamide |
| SMILES | CC(=O)N1CCCC12CN([C@H](C(N)=O)[C@@H](C)O)C2CS |
| InChI | InChI=1S/C13H23N3O3S/c1-8(17)11(12(14)19)15-7-13(10(15)6-20)4-3-5-16(13)9(2)18/h8,10-11,17,20H,3-7H2,1-2H3,(H2,14,19)/t8-,10?,11+,13?/m1/s1 |
| InChIKey | FBRSFKJKUJKUGE-FQMXNFKOSA-N |
| XLogP | -0.78 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|