About 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide
2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide (PubChem CID 139379424) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide |
| PubChem CID | 139379424 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide |
| SMILES | C=C1N(CC(N)=O)CC12CCCN2 |
| InChI | InChI=1S/C9H15N3O/c1-7-9(3-2-4-11-9)6-12(7)5-8(10)13/h11H,1-6H2,(H2,10,13) |
| InChIKey | BTTKHQRVGWEKCF-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide?
The IUPAC name of 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide (CID 139379424) is 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide.
What is the SMILES notation for 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide?
The canonical SMILES for 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide is C=C1N(CC(N)=O)CC12CCCN2.
What is the InChIKey of 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide?
The InChIKey is BTTKHQRVGWEKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-7-9(3-2-4-11-9)6-12(7)5-8(10)13/h11H,1-6H2,(H2,10,13).
What are the key properties of 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide?
2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide has a molecular weight of 181.24 g/mol, XLogP of -0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylidene-2,5-diazaspiro[3.4]octan-2-yl)acetamide is sourced from PubChem (CID 139379424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).