C13H21N3O2 — CID 139379451
(2S,3R)-2-(3-ethynyl-1-methyl-2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxybutanamide (PubChem CID 139379451) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2S,3R)-2-(3-ethynyl-1-methyl-2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxybutanamide.
| Compound Name | (2S,3R)-2-(3-ethynyl-1-methyl-2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxybutanamide |
|---|---|
| PubChem CID | 139379451 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (2S,3R)-2-(3-ethynyl-1-methyl-2,5-diazaspiro[3.4]octan-2-yl)-3-hydroxybutanamide |
| SMILES | C#CC1N([C@H](C(N)=O)[C@@H](C)O)C(C)C12CCCN2 |
| InChI | InChI=1S/C13H21N3O2/c1-4-10-13(6-5-7-15-13)9(3)16(10)11(8(2)17)12(14)18/h1,8-11,15,17H,5-7H2,2-3H3,(H2,14,18)/t8-,9?,10?,11+,13?/m1/s1 |
| InChIKey | LGAZDLPTSLOPLB-IITNWZNOSA-N |
| XLogP | -0.95 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|