About 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole
2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole (PubChem CID 139379682) has the molecular formula C21H11N3O2S
and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole |
| PubChem CID | 139379682 |
| Molecular Formula | C21H11N3O2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc4sc(-c5ccc6cnoc6c5)nc4c3)nc2c1 |
| InChI | InChI=1S/C21H11N3O2S/c1-2-4-17-15(3-1)23-20(25-17)12-7-8-19-16(9-12)24-21(27-19)13-5-6-14-11-22-26-18(14)10-13/h1-11H |
| InChIKey | RCALNBKOZUAIRW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole?
The IUPAC name of 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole (CID 139379682) is 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole.
What is the SMILES notation for 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole?
The canonical SMILES for 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole is c1ccc2oc(-c3ccc4sc(-c5ccc6cnoc6c5)nc4c3)nc2c1.
What is the InChIKey of 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole?
The InChIKey is RCALNBKOZUAIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11N3O2S/c1-2-4-17-15(3-1)23-20(25-17)12-7-8-19-16(9-12)24-21(27-19)13-5-6-14-11-22-26-18(14)10-13/h1-11H.
What are the key properties of 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole?
2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole has a molecular weight of 369.41 g/mol, XLogP of 5.91, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2-benzoxazol-6-yl)-1,3-benzothiazol-5-yl]-1,3-benzoxazole is sourced from PubChem (CID 139379682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).