C26H29F3N6O — CID 139379689
4-[1-(6-aminohexyl)indazol-4-yl]-6-[4-(methylamino)phenyl]-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 139379689) has the molecular formula C26H29F3N6O and a molecular weight of 498.55 g/mol. Its IUPAC name is 4-[1-(6-aminohexyl)indazol-4-yl]-6-[4-(methylamino)phenyl]-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 4-[1-(6-aminohexyl)indazol-4-yl]-6-[4-(methylamino)phenyl]-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 139379689 |
| Molecular Formula | C26H29F3N6O |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 4-[1-(6-aminohexyl)indazol-4-yl]-6-[4-(methylamino)phenyl]-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | CNc1ccc(-c2cc(-c3cccc4c3cnn4CCCCCCN)c(=O)n(CC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C26H29F3N6O/c1-31-19-11-9-18(10-12-19)23-15-21(25(36)35(33-23)17-26(27,28)29)20-7-6-8-24-22(20)16-32-34(24)14-5-3-2-4-13-30/h6-12,15-16,31H,2-5,13-14,17,30H2,1H3 |
| InChIKey | QRDQVZBAGNYDOH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|