About 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine
3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine (PubChem CID 139380626) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 139380626 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1=CCC(C)C(N)=C1SC(C)C |
| InChI | InChI=1S/C11H19NS/c1-7(2)13-11-9(4)6-5-8(3)10(11)12/h6-8H,5,12H2,1-4H3 |
| InChIKey | ZLIMDYWATSLOAS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine (CID 139380626) is 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine is CC1=CCC(C)C(N)=C1SC(C)C.
What is the InChIKey of 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine?
The InChIKey is ZLIMDYWATSLOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NS/c1-7(2)13-11-9(4)6-5-8(3)10(11)12/h6-8H,5,12H2,1-4H3.
What are the key properties of 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine?
3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine has a molecular weight of 197.35 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2-propan-2-ylsulfanylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 139380626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).