C60H111N — CID 139380677
(5S)-N-butyl-4-methyl-5-[[1-methyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexyl]methyl]-2-pentylcyclohexan-1-amine (PubChem CID 139380677) has the molecular formula C60H111N and a molecular weight of 846.55 g/mol. Its IUPAC name is (5S)-N-butyl-4-methyl-5-[[1-methyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexyl]methyl]-2-pentylcyclohexan-1-amine.
| Compound Name | (5S)-N-butyl-4-methyl-5-[[1-methyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexyl]methyl]-2-pentylcyclohexan-1-amine |
|---|---|
| PubChem CID | 139380677 |
| Molecular Formula | C60H111N |
| Molecular Weight | 846.55 g/mol |
| Exact Mass | 845.87 |
| IUPAC Name | (5S)-N-butyl-4-methyl-5-[[1-methyl-4,4-bis[(9Z,12Z)-octadeca-9,12-dienyl]cyclohexyl]methyl]-2-pentylcyclohexan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)CCC(C)(C[C@H]2CC(NCCCC)C(CCCCC)CC2C)CC1 |
| InChI | InChI=1S/C60H111N/c1-7-11-15-17-19-21-23-25-27-29-31-33-35-37-39-42-45-60(46-43-40-38-36-34-32-30-28-26-24-22-20-18-16-12-8-2)49-47-59(6,48-50-60)54-57-53-58(61-51-14-10-4)56(52-55(57)5)44-41-13-9-3/h19-22,25-28,55-58,61H,7-18,23-24,29-54H2,1-6H3/b21-19-,22-20-,27-25-,28-26-/t55?,56?,57-,58?/m1/s1 |
| InChIKey | COSVPDRYZWENKS-MASKIJCLSA-N |
| XLogP | 20.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.55 |
| LogP ≤ 5 | 20.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|