C10H17N3 — CID 139380719
N,N,6-trimethyl-4-(methyldiazenyl)cyclohexa-2,4-dien-1-amine (PubChem CID 139380719) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N,N,6-trimethyl-4-(methyldiazenyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | N,N,6-trimethyl-4-(methyldiazenyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 139380719 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N,N,6-trimethyl-4-(methyldiazenyl)cyclohexa-2,4-dien-1-amine |
| SMILES | C/N=N/C1=CC(C)C(N(C)C)C=C1 |
| InChI | InChI=1S/C10H17N3/c1-8-7-9(12-11-2)5-6-10(8)13(3)4/h5-8,10H,1-4H3/b12-11+ |
| InChIKey | HPBORRJLPTVWCO-VAWYXSNFSA-N |
| XLogP | 2.09 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|