C26H26N2+2 — CID 139380783
8-ethyl-11,11-dimethyl-14-(2-methylphenyl)-8,14-diazoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene (PubChem CID 139380783) has the molecular formula C26H26N2+2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 8-ethyl-11,11-dimethyl-14-(2-methylphenyl)-8,14-diazoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene.
| Compound Name | 8-ethyl-11,11-dimethyl-14-(2-methylphenyl)-8,14-diazoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
|---|---|
| PubChem CID | 139380783 |
| Molecular Formula | C26H26N2+2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 8-ethyl-11,11-dimethyl-14-(2-methylphenyl)-8,14-diazoniatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaene |
| SMILES | CC[n+]1cc2c(c3ccccc31)-c1cc[n+](-c3ccccc3C)cc1C2(C)C |
| InChI | InChI=1S/C26H26N2/c1-5-27-17-22-25(20-11-7-9-13-24(20)27)19-14-15-28(16-21(19)26(22,3)4)23-12-8-6-10-18(23)2/h6-17H,5H2,1-4H3/q+2 |
| InChIKey | PWWBKAAAMJYRCX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|