C47H80N2O2 — CID 139380908
2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-(pyridin-4-ylmethyl)ethanamine (PubChem CID 139380908) has the molecular formula C47H80N2O2 and a molecular weight of 705.17 g/mol. Its IUPAC name is 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-(pyridin-4-ylmethyl)ethanamine.
| Compound Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-(pyridin-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 139380908 |
| Molecular Formula | C47H80N2O2 |
| Molecular Weight | 705.17 g/mol |
| Exact Mass | 704.62 |
| IUPAC Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N-(pyridin-4-ylmethyl)ethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCNCc2ccncc2)O1 |
| InChI | InChI=1S/C47H80N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-47(50-44-46(51-47)37-42-49-43-45-35-40-48-41-36-45)39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,35-36,40-41,46,49H,3-10,15-16,21-34,37-39,42-44H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | SZUBSMVRNOSZKY-MAZCIEHSSA-N |
| XLogP | 14.08 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.17 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|