About 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid
2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid (PubChem CID 139380932) has the molecular formula C10H18O6
and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid |
| PubChem CID | 139380932 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid |
| SMILES | CC1(C)OCC(CO)(COCC(=O)O)CO1 |
| InChI | InChI=1S/C10H18O6/c1-9(2)15-6-10(4-11,7-16-9)5-14-3-8(12)13/h11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | XGHGMKOCBVKOPS-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid?
The IUPAC name of 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid (CID 139380932) is 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid.
What is the SMILES notation for 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid?
The canonical SMILES for 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid is CC1(C)OCC(CO)(COCC(=O)O)CO1.
What is the InChIKey of 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid?
The InChIKey is XGHGMKOCBVKOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O6/c1-9(2)15-6-10(4-11,7-16-9)5-14-3-8(12)13/h11H,3-7H2,1-2H3,(H,12,13).
What are the key properties of 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid?
2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid has a molecular weight of 234.25 g/mol, XLogP of -0.15, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]acetic acid is sourced from PubChem (CID 139380932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).