C11H12BrFN6O4S — CID 139381447
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-sulfamoylethylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139381447) has the molecular formula C11H12BrFN6O4S and a molecular weight of 423.22 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-sulfamoylethylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-sulfamoylethylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139381447 |
| Molecular Formula | C11H12BrFN6O4S |
| Molecular Weight | 423.22 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-sulfamoylethylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)CCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C11H12BrFN6O4S/c12-7-5-6(1-2-8(7)13)16-11(17-20)9-10(19-23-18-9)15-3-4-24(14,21)22/h1-2,5,20H,3-4H2,(H,15,19)(H,16,17)(H2,14,21,22) |
| InChIKey | KCXFIXLRCRISPS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|