C40H24N4O — CID 139381584
3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]phenyl]benzonitrile (PubChem CID 139381584) has the molecular formula C40H24N4O and a molecular weight of 576.66 g/mol. Its IUPAC name is 3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]phenyl]benzonitrile.
| Compound Name | 3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139381584 |
| Molecular Formula | C40H24N4O |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 3-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(-c3ccc4c(oc5ccccc54)c3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c1 |
| InChI | InChI=1S/C40H24N4O/c41-25-26-10-9-15-31(24-26)27-18-20-28(21-19-27)32-22-23-34-33-16-7-8-17-35(33)45-37(34)36(32)40-43-38(29-11-3-1-4-12-29)42-39(44-40)30-13-5-2-6-14-30/h1-24H |
| InChIKey | ZRDVIKGZWUJACJ-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |