C12H14BrFN6O4S — CID 139381795
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-sulfamoylpropylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139381795) has the molecular formula C12H14BrFN6O4S and a molecular weight of 437.25 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-sulfamoylpropylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-sulfamoylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139381795 |
| Molecular Formula | C12H14BrFN6O4S |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-sulfamoylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)CCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C12H14BrFN6O4S/c13-8-6-7(2-3-9(8)14)17-12(18-21)10-11(20-24-19-10)16-4-1-5-25(15,22)23/h2-3,6,21H,1,4-5H2,(H,16,20)(H,17,18)(H2,15,22,23) |
| InChIKey | MYJXMCWXQKZHJB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|