About (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine
(2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine (PubChem CID 139381985) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine |
| PubChem CID | 139381985 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(/C)N(N(C)C=C)N(C=C)CC |
| InChI | InChI=1S/C12H21N3/c1-7-11-12(5)15(13(6)8-2)14(9-3)10-4/h7-9,11H,1-3,10H2,4-6H3/b12-11- |
| InChIKey | FMZFQGYTKSYVAW-QXMHVHEDSA-N |
| XLogP | 2.75 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine?
The IUPAC name of (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine (CID 139381985) is (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine.
What is the SMILES notation for (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine?
The canonical SMILES for (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine is C=C/C=C(/C)N(N(C)C=C)N(C=C)CC.
What is the InChIKey of (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine?
The InChIKey is FMZFQGYTKSYVAW-QXMHVHEDSA-N. The full InChI is InChI=1S/C12H21N3/c1-7-11-12(5)15(13(6)8-2)14(9-3)10-4/h7-9,11H,1-3,10H2,4-6H3/b12-11-.
What are the key properties of (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine?
(2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine has a molecular weight of 207.32 g/mol, XLogP of 2.75, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-[ethenyl(ethyl)amino]-N-[ethenyl(methyl)amino]penta-2,4-dien-2-amine is sourced from PubChem (CID 139381985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).