C20H25N5O3 — CID 139382380
N-[2-hydroxy-5-[1-methyl-5-(methylamino)pyrazolo[3,4-c]pyridin-7-yl]oxy-1-phenylpentyl]formamide (PubChem CID 139382380) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[2-hydroxy-5-[1-methyl-5-(methylamino)pyrazolo[3,4-c]pyridin-7-yl]oxy-1-phenylpentyl]formamide.
| Compound Name | N-[2-hydroxy-5-[1-methyl-5-(methylamino)pyrazolo[3,4-c]pyridin-7-yl]oxy-1-phenylpentyl]formamide |
|---|---|
| PubChem CID | 139382380 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[2-hydroxy-5-[1-methyl-5-(methylamino)pyrazolo[3,4-c]pyridin-7-yl]oxy-1-phenylpentyl]formamide |
| SMILES | CNc1cc2cnn(C)c2c(OCCCC(O)C(NC=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H25N5O3/c1-21-17-11-15-12-23-25(2)19(15)20(24-17)28-10-6-9-16(27)18(22-13-26)14-7-4-3-5-8-14/h3-5,7-8,11-13,16,18,27H,6,9-10H2,1-2H3,(H,21,24)(H,22,26) |
| InChIKey | CGVJLQLKSWKPCM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|