C25H28N6O2 — CID 139382600
tert-butyl N-[1-(4-amino-6-methyl-5-quinolin-3-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl)but-3-en-2-yl]carbamate (PubChem CID 139382600) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is tert-butyl N-[1-(4-amino-6-methyl-5-quinolin-3-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-amino-6-methyl-5-quinolin-3-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 139382600 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | tert-butyl N-[1-(4-amino-6-methyl-5-quinolin-3-ylpyrrolo[2,1-f][1,2,4]triazin-7-yl)but-3-en-2-yl]carbamate |
| SMILES | C=CC(Cc1c(C)c(-c2cnc3ccccc3c2)c2c(N)ncnn12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H28N6O2/c1-6-18(30-24(32)33-25(3,4)5)12-20-15(2)21(22-23(26)28-14-29-31(20)22)17-11-16-9-7-8-10-19(16)27-13-17/h6-11,13-14,18H,1,12H2,2-5H3,(H,30,32)(H2,26,28,29) |
| InChIKey | JEPCGMDUSRHZTR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|