About N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine
N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine (PubChem CID 139383038) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine.
Analyze N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine?
The IUPAC name of N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine (CID 139383038) is N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine.
What is the SMILES notation for N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine?
The canonical SMILES for N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine is C=C=CC(CC(=C)N(C)C)SC.
What is the InChIKey of N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine?
The InChIKey is NDVUKVPADXUBRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-6-7-10(12-5)8-9(2)11(3)4/h7,10H,1-2,8H2,3-5H3.
What are the key properties of N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine?
N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine has a molecular weight of 183.32 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-methylsulfanylhepta-1,5,6-trien-2-amine is sourced from PubChem (CID 139383038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).