C15H24O2 — CID 139383132
(3S,6S,7Z)-pentadeca-1,7-dien-4-yne-3,6-diol (PubChem CID 139383132) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is (3S,6S,7Z)-pentadeca-1,7-dien-4-yne-3,6-diol.
| Compound Name | (3S,6S,7Z)-pentadeca-1,7-dien-4-yne-3,6-diol |
|---|---|
| PubChem CID | 139383132 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3S,6S,7Z)-pentadeca-1,7-dien-4-yne-3,6-diol |
| SMILES | C=C[C@H](O)C#C[C@@H](O)/C=C\CCCCCCC |
| InChI | InChI=1S/C15H24O2/c1-3-5-6-7-8-9-10-11-15(17)13-12-14(16)4-2/h4,10-11,14-17H,2-3,5-9H2,1H3/b11-10-/t14-,15-/m0/s1 |
| InChIKey | NFLUODVHUXAQCH-PBARLCFESA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|