About 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide
3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide (PubChem CID 139383540) has the molecular formula C22H30F2N2O2
and a molecular weight of 392.49 g/mol. Its IUPAC name is 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide.
Molecular Properties
| Compound Name | 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide |
| PubChem CID | 139383540 |
| Molecular Formula | C22H30F2N2O2 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide |
| SMILES | COC1(c2cccc(C(N)=O)c2)C2CCCC1CN(C1CCC(F)(F)CC1)C2 |
| InChI | InChI=1S/C22H30F2N2O2/c1-28-22(16-5-2-4-15(12-16)20(25)27)17-6-3-7-18(22)14-26(13-17)19-8-10-21(23,24)11-9-19/h2,4-5,12,17-19H,3,6-11,13-14H2,1H3,(H2,25,27) |
| InChIKey | UBMJENIMJKFCJR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The IUPAC name of 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide (CID 139383540) is 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide.
What is the SMILES notation for 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The canonical SMILES for 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide is COC1(c2cccc(C(N)=O)c2)C2CCCC1CN(C1CCC(F)(F)CC1)C2.
What is the InChIKey of 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
The InChIKey is UBMJENIMJKFCJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30F2N2O2/c1-28-22(16-5-2-4-15(12-16)20(25)27)17-6-3-7-18(22)14-26(13-17)19-8-10-21(23,24)11-9-19/h2,4-5,12,17-19H,3,6-11,13-14H2,1H3,(H2,25,27).
What are the key properties of 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide?
3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide has a molecular weight of 392.49 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4,4-difluorocyclohexyl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]benzamide is sourced from PubChem (CID 139383540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).