About 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one
1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one (PubChem CID 139383969) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one.
Molecular Properties
| Compound Name | 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one |
| PubChem CID | 139383969 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one |
| SMILES | CN1CC=CCC2(CCCN2C)C1=O |
| InChI | InChI=1S/C11H18N2O/c1-12-8-4-3-6-11(10(12)14)7-5-9-13(11)2/h3-4H,5-9H2,1-2H3 |
| InChIKey | JLDGYWDDCIHWBW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one?
The IUPAC name of 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one (CID 139383969) is 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one.
What is the SMILES notation for 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one?
The canonical SMILES for 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one is CN1CC=CCC2(CCCN2C)C1=O.
What is the InChIKey of 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one?
The InChIKey is JLDGYWDDCIHWBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-12-8-4-3-6-11(10(12)14)7-5-9-13(11)2/h3-4H,5-9H2,1-2H3.
What are the key properties of 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one?
1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one has a molecular weight of 194.28 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-dimethyl-1,10-diazaspiro[4.6]undec-7-en-11-one is sourced from PubChem (CID 139383969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).