About 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione
4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione (PubChem CID 139384535) has the molecular formula C10H18O3S2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione.
Molecular Properties
| Compound Name | 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione |
| PubChem CID | 139384535 |
| Molecular Formula | C10H18O3S2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione |
| SMILES | CCOC(CCC1COC(=S)S1)OCC |
| InChI | InChI=1S/C10H18O3S2/c1-3-11-9(12-4-2)6-5-8-7-13-10(14)15-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | UPDHDDZLIXJMOL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione?
The IUPAC name of 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione (CID 139384535) is 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione.
What is the SMILES notation for 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione?
The canonical SMILES for 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione is CCOC(CCC1COC(=S)S1)OCC.
What is the InChIKey of 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione?
The InChIKey is UPDHDDZLIXJMOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3S2/c1-3-11-9(12-4-2)6-5-8-7-13-10(14)15-8/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione?
4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione has a molecular weight of 250.38 g/mol, XLogP of 2.58, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-diethoxypropyl)-1,3-oxathiolane-2-thione is sourced from PubChem (CID 139384535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).