C12H16N2O5 — CID 139384577
(E)-2-[1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide (PubChem CID 139384577) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (E)-2-[1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide.
| Compound Name | (E)-2-[1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide |
|---|---|
| PubChem CID | 139384577 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (E)-2-[1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide |
| SMILES | CCC(=C1OC(=O)OC1(C)C)/C(=C\C(N)=O)C(N)=O |
| InChI | InChI=1S/C12H16N2O5/c1-4-6(7(10(14)16)5-8(13)15)9-12(2,3)19-11(17)18-9/h5H,4H2,1-3H3,(H2,13,15)(H2,14,16)/b7-5+,9-6? |
| InChIKey | ICWDKLUZGZLXIE-ZJRYPJFSSA-N |
| XLogP | 0.49 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|