C14H16FN3O3 — CID 139384620
2-[(3-cyano-5-fluorophenyl)carbamoylamino]-2-ethylbutanoic acid (PubChem CID 139384620) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(3-cyano-5-fluorophenyl)carbamoylamino]-2-ethylbutanoic acid.
| Compound Name | 2-[(3-cyano-5-fluorophenyl)carbamoylamino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 139384620 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[(3-cyano-5-fluorophenyl)carbamoylamino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(NC(=O)Nc1cc(F)cc(C#N)c1)C(=O)O |
| InChI | InChI=1S/C14H16FN3O3/c1-3-14(4-2,12(19)20)18-13(21)17-11-6-9(8-16)5-10(15)7-11/h5-7H,3-4H2,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | MTQASGMVYPBPCT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |