About 2-methyl-4-phenyl-6H-1,3-oxazine
2-methyl-4-phenyl-6H-1,3-oxazine (PubChem CID 139384710) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-methyl-4-phenyl-6H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-methyl-4-phenyl-6H-1,3-oxazine |
| PubChem CID | 139384710 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-methyl-4-phenyl-6H-1,3-oxazine |
| SMILES | CC1=NC(c2ccccc2)=CCO1 |
| InChI | InChI=1S/C11H11NO/c1-9-12-11(7-8-13-9)10-5-3-2-4-6-10/h2-7H,8H2,1H3 |
| InChIKey | GLMWYQBFFOHUNW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-phenyl-6H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenyl-6H-1,3-oxazine?
The IUPAC name of 2-methyl-4-phenyl-6H-1,3-oxazine (CID 139384710) is 2-methyl-4-phenyl-6H-1,3-oxazine.
What is the SMILES notation for 2-methyl-4-phenyl-6H-1,3-oxazine?
The canonical SMILES for 2-methyl-4-phenyl-6H-1,3-oxazine is CC1=NC(c2ccccc2)=CCO1.
What is the InChIKey of 2-methyl-4-phenyl-6H-1,3-oxazine?
The InChIKey is GLMWYQBFFOHUNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-9-12-11(7-8-13-9)10-5-3-2-4-6-10/h2-7H,8H2,1H3.
What are the key properties of 2-methyl-4-phenyl-6H-1,3-oxazine?
2-methyl-4-phenyl-6H-1,3-oxazine has a molecular weight of 173.21 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenyl-6H-1,3-oxazine is sourced from PubChem (CID 139384710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).