C37H40N6O5S2 — CID 139384769
methyl-[(2S)-1-[2-[2-[(2R,6S)-6-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-sulfanylmethyl]morpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid (PubChem CID 139384769) has the molecular formula C37H40N6O5S2 and a molecular weight of 712.90 g/mol. Its IUPAC name is methyl-[(2S)-1-[2-[2-[(2R,6S)-6-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-sulfanylmethyl]morpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid.
| Compound Name | methyl-[(2S)-1-[2-[2-[(2R,6S)-6-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-sulfanylmethyl]morpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 139384769 |
| Molecular Formula | C37H40N6O5S2 |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.25 |
| IUPAC Name | methyl-[(2S)-1-[2-[2-[(2R,6S)-6-[[5-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-sulfanylmethyl]morpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamic acid |
| SMILES | Cc1nc(Cc2nnc(C(S)C3CNC[C@@H](CCc4ccccc4NC(=O)[C@H](C(c4ccccc4)c4ccccc4)N(C)C(=O)O)O3)o2)cs1 |
| InChI | InChI=1S/C37H40N6O5S2/c1-23-39-27(22-50-23)19-31-41-42-36(48-31)34(49)30-21-38-20-28(47-30)18-17-24-11-9-10-16-29(24)40-35(44)33(43(2)37(45)46)32(25-12-5-3-6-13-25)26-14-7-4-8-15-26/h3-16,22,28,30,32-34,38,49H,17-21H2,1-2H3,(H,40,44)(H,45,46)/t28-,30?,33+,34?/m1/s1 |
| InChIKey | YDYDUWGYCYZLSW-TWRJZCOSSA-N |
| XLogP | 6.14 |
| TPSA | 142.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|