C20H37NS — CID 139385072
5-hexyl-2-(4-methyldecan-5-yl)-1,3-thiazole (PubChem CID 139385072) has the molecular formula C20H37NS and a molecular weight of 323.59 g/mol. Its IUPAC name is 5-hexyl-2-(4-methyldecan-5-yl)-1,3-thiazole.
| Compound Name | 5-hexyl-2-(4-methyldecan-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 139385072 |
| Molecular Formula | C20H37NS |
| Molecular Weight | 323.59 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 5-hexyl-2-(4-methyldecan-5-yl)-1,3-thiazole |
| SMILES | CCCCCCc1cnc(C(CCCCC)C(C)CCC)s1 |
| InChI | InChI=1S/C20H37NS/c1-5-8-10-12-14-18-16-21-20(22-18)19(15-11-9-6-2)17(4)13-7-3/h16-17,19H,5-15H2,1-4H3 |
| InChIKey | KRFKSFVYBMETNH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.59 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|