C9H14Cl3N3O3 — CID 139385098
[(3S,4R)-1-acetyl-4-aminopyrrolidin-3-yl]-(2,2,2-trichloroethyl)carbamic acid (PubChem CID 139385098) has the molecular formula C9H14Cl3N3O3 and a molecular weight of 318.59 g/mol. Its IUPAC name is [(3S,4R)-1-acetyl-4-aminopyrrolidin-3-yl]-(2,2,2-trichloroethyl)carbamic acid.
| Compound Name | [(3S,4R)-1-acetyl-4-aminopyrrolidin-3-yl]-(2,2,2-trichloroethyl)carbamic acid |
|---|---|
| PubChem CID | 139385098 |
| Molecular Formula | C9H14Cl3N3O3 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | [(3S,4R)-1-acetyl-4-aminopyrrolidin-3-yl]-(2,2,2-trichloroethyl)carbamic acid |
| SMILES | CC(=O)N1C[C@@H](N)[C@@H](N(CC(Cl)(Cl)Cl)C(=O)O)C1 |
| InChI | InChI=1S/C9H14Cl3N3O3/c1-5(16)14-2-6(13)7(3-14)15(8(17)18)4-9(10,11)12/h6-7H,2-4,13H2,1H3,(H,17,18)/t6-,7+/m1/s1 |
| InChIKey | RCPMDZSDEJLLHD-RQJHMYQMSA-N |
| XLogP | 0.89 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|